C27H26O2 — CID 170959833
(3E)-1,1,2-triphenyl-3-[(Z)-prop-1-enyl]hexa-3,5-diene-1,2-diol (PubChem CID 170959833) has the molecular formula C27H26O2 and a molecular weight of 382.50 g/mol. Its IUPAC name is (3E)-1,1,2-triphenyl-3-[(Z)-prop-1-enyl]hexa-3,5-diene-1,2-diol.
| Compound Name | (3E)-1,1,2-triphenyl-3-[(Z)-prop-1-enyl]hexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 170959833 |
| Molecular Formula | C27H26O2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (3E)-1,1,2-triphenyl-3-[(Z)-prop-1-enyl]hexa-3,5-diene-1,2-diol |
| SMILES | C=C/C=C(\C=C/C)C(O)(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26O2/c1-3-14-22(15-4-2)26(28,23-16-8-5-9-17-23)27(29,24-18-10-6-11-19-24)25-20-12-7-13-21-25/h3-21,28-29H,1H2,2H3/b15-4-,22-14+ |
| InChIKey | ZURCGXJHJZJCJH-ZUJCFALVSA-N |
| XLogP | 5.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|