C27H31NO4 — CID 156746947
2-[[(2E)-1,1-diphenyl-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]carbonylamino]ethyl 2-methylprop-2-enoate;molecular hydrogen (PubChem CID 156746947) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[[(2E)-1,1-diphenyl-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]carbonylamino]ethyl 2-methylprop-2-enoate;molecular hydrogen.
| Compound Name | 2-[[(2E)-1,1-diphenyl-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]carbonylamino]ethyl 2-methylprop-2-enoate;molecular hydrogen |
|---|---|
| PubChem CID | 156746947 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 2-[[(2E)-1,1-diphenyl-2-[(Z)-prop-1-enyl]penta-2,4-dienoxy]carbonylamino]ethyl 2-methylprop-2-enoate;molecular hydrogen |
| SMILES | C=C/C=C(\C=C/C)C(OC(=O)NCCOC(=O)C(=C)C)(c1ccccc1)c1ccccc1.[H][H] |
| InChI | InChI=1S/C27H29NO4.H2/c1-5-13-22(14-6-2)27(23-15-9-7-10-16-23,24-17-11-8-12-18-24)32-26(30)28-19-20-31-25(29)21(3)4;/h5-18H,1,3,19-20H2,2,4H3,(H,28,30);1H/b14-6-,22-13+; |
| InChIKey | PQUJPQFISDBPCC-IHARZZIPSA-N |
| XLogP | 5.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|