C15H26N2O5 — CID 142301997
2-amino-3-phenylpropanoic acid;2-(hydroxyamino)ethyl 2-methylprop-2-enoate;molecular hydrogen (PubChem CID 142301997) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-amino-3-phenylpropanoic acid;2-(hydroxyamino)ethyl 2-methylprop-2-enoate;molecular hydrogen.
| Compound Name | 2-amino-3-phenylpropanoic acid;2-(hydroxyamino)ethyl 2-methylprop-2-enoate;molecular hydrogen |
|---|---|
| PubChem CID | 142301997 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-amino-3-phenylpropanoic acid;2-(hydroxyamino)ethyl 2-methylprop-2-enoate;molecular hydrogen |
| SMILES | C=C(C)C(=O)OCCNO.NC(Cc1ccccc1)C(=O)O.[H][H].[H][H] |
| InChI | InChI=1S/C9H11NO2.C6H11NO3.2H2/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-5(2)6(8)10-4-3-7-9;;/h1-5,8H,6,10H2,(H,11,12);7,9H,1,3-4H2,2H3;2*1H |
| InChIKey | VVPHBQJGKAKCCC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|