C29H34 — CID 144915039
[(3E,7E)-4,7-bis[(Z)-prop-1-enyl]-6-[(1E)-1-[(Z)-prop-1-enyl]buta-1,3-dienyl]deca-1,3,7,9-tetraen-5-yl]benzene (PubChem CID 144915039) has the molecular formula C29H34 and a molecular weight of 382.59 g/mol. Its IUPAC name is [(3E,7E)-4,7-bis[(Z)-prop-1-enyl]-6-[(1E)-1-[(Z)-prop-1-enyl]buta-1,3-dienyl]deca-1,3,7,9-tetraen-5-yl]benzene.
| Compound Name | [(3E,7E)-4,7-bis[(Z)-prop-1-enyl]-6-[(1E)-1-[(Z)-prop-1-enyl]buta-1,3-dienyl]deca-1,3,7,9-tetraen-5-yl]benzene |
|---|---|
| PubChem CID | 144915039 |
| Molecular Formula | C29H34 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | [(3E,7E)-4,7-bis[(Z)-prop-1-enyl]-6-[(1E)-1-[(Z)-prop-1-enyl]buta-1,3-dienyl]deca-1,3,7,9-tetraen-5-yl]benzene |
| SMILES | C=C/C=C(\C=C/C)C(C(/C=C\C)=C/C=C)C(C(/C=C\C)=C/C=C)c1ccccc1 |
| InChI | InChI=1S/C29H34/c1-7-16-24(17-8-2)28(25(18-9-3)19-10-4)29(26(20-11-5)21-12-6)27-22-14-13-15-23-27/h7-23,28-29H,1,3,5H2,2,4,6H3/b17-8-,19-10-,21-12-,24-16+,25-18+,26-20+ |
| InChIKey | BYWRDTAXVZGCAN-SNEHRBFWSA-N |
| XLogP | 8.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|