C34H39KO — CID 176935522
potassium;carbanide;2-ethenoxy-1,5-bis(1-phenylethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]benzene (PubChem CID 176935522) has the molecular formula C34H39KO and a molecular weight of 502.78 g/mol. Its IUPAC name is potassium;carbanide;2-ethenoxy-1,5-bis(1-phenylethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]benzene.
| Compound Name | potassium;carbanide;2-ethenoxy-1,5-bis(1-phenylethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]benzene |
|---|---|
| PubChem CID | 176935522 |
| Molecular Formula | C34H39KO |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | potassium;carbanide;2-ethenoxy-1,5-bis(1-phenylethyl)-3-[(3E)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-yl]benzene |
| SMILES | C=C/C=C(\C=C/C)C(C)c1cc(C(C)c2ccccc2)cc(C(C)c2ccccc2)c1OC=C.[CH3-].[K+] |
| InChI | InChI=1S/C33H36O.CH3.K/c1-7-16-27(17-8-2)25(5)31-22-30(24(4)28-18-12-10-13-19-28)23-32(33(31)34-9-3)26(6)29-20-14-11-15-21-29;;/h7-26H,1,3H2,2,4-6H3;1H3;/q;-1;+1/b17-8-,27-16+;; |
| InChIKey | VRVHXPIWCNODPQ-VOFBAHSQSA-N |
| XLogP | 6.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|