About CID 59039626
CID 59039626 (PubChem CID 59039626) has the molecular formula C23H22O
and a molecular weight of 314.43 g/mol.
Molecular Properties
| Compound Name | CID 59039626 |
| PubChem CID | 59039626 |
| Molecular Formula | C23H22O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | — |
| SMILES | [CH]Oc1ccc(C(C)c2ccccc2)cc1C(C)c1ccccc1 |
| InChI | InChI=1S/C23H22O/c1-17(19-10-6-4-7-11-19)21-14-15-23(24-3)22(16-21)18(2)20-12-8-5-9-13-20/h3-18H,1-2H3 |
| InChIKey | VDSKEWJYWARKFI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59039626 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59039626?
The IUPAC name of CID 59039626 (CID 59039626) is not available.
What is the SMILES notation for CID 59039626?
The canonical SMILES for CID 59039626 is [CH]Oc1ccc(C(C)c2ccccc2)cc1C(C)c1ccccc1.
What is the InChIKey of CID 59039626?
The InChIKey is VDSKEWJYWARKFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O/c1-17(19-10-6-4-7-11-19)21-14-15-23(24-3)22(16-21)18(2)20-12-8-5-9-13-20/h3-18H,1-2H3.
What are the key properties of CID 59039626?
CID 59039626 has a molecular weight of 314.43 g/mol, XLogP of 6.04, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59039626 is sourced from PubChem (CID 59039626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).