C64H64O3 — CID 68867034
2-methylprop-2-enoic acid;1,3,5-tris(1-phenylethyl)-2-[2,4,6-tris(1-phenylethyl)phenoxy]benzene (PubChem CID 68867034) has the molecular formula C64H64O3 and a molecular weight of 881.21 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;1,3,5-tris(1-phenylethyl)-2-[2,4,6-tris(1-phenylethyl)phenoxy]benzene.
| Compound Name | 2-methylprop-2-enoic acid;1,3,5-tris(1-phenylethyl)-2-[2,4,6-tris(1-phenylethyl)phenoxy]benzene |
|---|---|
| PubChem CID | 68867034 |
| Molecular Formula | C64H64O3 |
| Molecular Weight | 881.21 g/mol |
| Exact Mass | 880.49 |
| IUPAC Name | 2-methylprop-2-enoic acid;1,3,5-tris(1-phenylethyl)-2-[2,4,6-tris(1-phenylethyl)phenoxy]benzene |
| SMILES | C=C(C)C(=O)O.CC(c1ccccc1)c1cc(C(C)c2ccccc2)c(Oc2c(C(C)c3ccccc3)cc(C(C)c3ccccc3)cc2C(C)c2ccccc2)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C60H58O.C4H6O2/c1-41(47-25-13-7-14-26-47)53-37-55(43(3)49-29-17-9-18-30-49)59(56(38-53)44(4)50-31-19-10-20-32-50)61-60-57(45(5)51-33-21-11-22-34-51)39-54(42(2)48-27-15-8-16-28-48)40-58(60)46(6)52-35-23-12-24-36-52;1-3(2)4(5)6/h7-46H,1-6H3;1H2,2H3,(H,5,6) |
| InChIKey | ZMEOQSPSHNKBRQ-UHFFFAOYSA-N |
| XLogP | 17.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.21 |
| LogP ≤ 5 | 17.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|