C44H54O3 — CID 174319383
2,6-dimethyl-6-[3-methyl-3-[2,4,6-tris(1-phenylethyl)phenoxy]butoxy]hept-1-en-3-one (PubChem CID 174319383) has the molecular formula C44H54O3 and a molecular weight of 630.91 g/mol. Its IUPAC name is 2,6-dimethyl-6-[3-methyl-3-[2,4,6-tris(1-phenylethyl)phenoxy]butoxy]hept-1-en-3-one.
| Compound Name | 2,6-dimethyl-6-[3-methyl-3-[2,4,6-tris(1-phenylethyl)phenoxy]butoxy]hept-1-en-3-one |
|---|---|
| PubChem CID | 174319383 |
| Molecular Formula | C44H54O3 |
| Molecular Weight | 630.91 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | 2,6-dimethyl-6-[3-methyl-3-[2,4,6-tris(1-phenylethyl)phenoxy]butoxy]hept-1-en-3-one |
| SMILES | C=C(C)C(=O)CCC(C)(C)OCCC(C)(C)Oc1c(C(C)c2ccccc2)cc(C(C)c2ccccc2)cc1C(C)c1ccccc1 |
| InChI | InChI=1S/C44H54O3/c1-31(2)41(45)25-26-43(6,7)46-28-27-44(8,9)47-42-39(33(4)36-21-15-11-16-22-36)29-38(32(3)35-19-13-10-14-20-35)30-40(42)34(5)37-23-17-12-18-24-37/h10-24,29-30,32-34H,1,25-28H2,2-9H3 |
| InChIKey | FXXIMUVQKPQZJG-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.91 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|