C25H27O5S- — CID 153310753
2-[4-methyl-2,6-bis(1-phenylethyl)phenoxy]ethyl sulfate (PubChem CID 153310753) has the molecular formula C25H27O5S- and a molecular weight of 439.55 g/mol. Its IUPAC name is 2-[4-methyl-2,6-bis(1-phenylethyl)phenoxy]ethyl sulfate.
| Compound Name | 2-[4-methyl-2,6-bis(1-phenylethyl)phenoxy]ethyl sulfate |
|---|---|
| PubChem CID | 153310753 |
| Molecular Formula | C25H27O5S- |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[4-methyl-2,6-bis(1-phenylethyl)phenoxy]ethyl sulfate |
| SMILES | Cc1cc(C(C)c2ccccc2)c(OCCOS(=O)(=O)[O-])c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H28O5S/c1-18-16-23(19(2)21-10-6-4-7-11-21)25(29-14-15-30-31(26,27)28)24(17-18)20(3)22-12-8-5-9-13-22/h4-13,16-17,19-20H,14-15H2,1-3H3,(H,26,27,28)/p-1 |
| InChIKey | ALPPNDITIFQXOU-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|