C32H35O5P — CID 22978799
2-[2,4,6-tris(1-phenylethyl)phenoxy]ethyl dihydrogen phosphate (PubChem CID 22978799) has the molecular formula C32H35O5P and a molecular weight of 530.60 g/mol. Its IUPAC name is 2-[2,4,6-tris(1-phenylethyl)phenoxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[2,4,6-tris(1-phenylethyl)phenoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 22978799 |
| Molecular Formula | C32H35O5P |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 2-[2,4,6-tris(1-phenylethyl)phenoxy]ethyl dihydrogen phosphate |
| SMILES | CC(c1ccccc1)c1cc(C(C)c2ccccc2)c(OCCOP(=O)(O)O)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C32H35O5P/c1-23(26-13-7-4-8-14-26)29-21-30(24(2)27-15-9-5-10-16-27)32(36-19-20-37-38(33,34)35)31(22-29)25(3)28-17-11-6-12-18-28/h4-18,21-25H,19-20H2,1-3H3,(H2,33,34,35) |
| InChIKey | IFWRZZMKGJYHAU-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|