C25H27NO2 — CID 163785441
2-(oxiran-2-ylmethoxy)-3,5-bis(1-phenylethyl)aniline (PubChem CID 163785441) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxy)-3,5-bis(1-phenylethyl)aniline.
| Compound Name | 2-(oxiran-2-ylmethoxy)-3,5-bis(1-phenylethyl)aniline |
|---|---|
| PubChem CID | 163785441 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-(oxiran-2-ylmethoxy)-3,5-bis(1-phenylethyl)aniline |
| SMILES | CC(c1ccccc1)c1cc(N)c(OCC2CO2)c(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C25H27NO2/c1-17(19-9-5-3-6-10-19)21-13-23(18(2)20-11-7-4-8-12-20)25(24(26)14-21)28-16-22-15-27-22/h3-14,17-18,22H,15-16,26H2,1-2H3 |
| InChIKey | MSDHHAKMRGQLQL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 47.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|