C23H30O2 — CID 143190670
2-[[3-[1-(2,3-dimethylphenyl)ethyl]-2,4,5,6-tetramethylphenoxy]methyl]oxirane (PubChem CID 143190670) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2-[[3-[1-(2,3-dimethylphenyl)ethyl]-2,4,5,6-tetramethylphenoxy]methyl]oxirane.
| Compound Name | 2-[[3-[1-(2,3-dimethylphenyl)ethyl]-2,4,5,6-tetramethylphenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 143190670 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-[[3-[1-(2,3-dimethylphenyl)ethyl]-2,4,5,6-tetramethylphenoxy]methyl]oxirane |
| SMILES | Cc1cccc(C(C)c2c(C)c(C)c(C)c(OCC3CO3)c2C)c1C |
| InChI | InChI=1S/C23H30O2/c1-13-9-8-10-21(14(13)2)18(6)22-16(4)15(3)17(5)23(19(22)7)25-12-20-11-24-20/h8-10,18,20H,11-12H2,1-7H3 |
| InChIKey | HYXYESFINVWFFN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|