C17H24O3 — CID 89179632
2-[[3-(2-methylbutyl)-2-(oxiran-2-ylmethoxy)phenyl]methyl]oxirane (PubChem CID 89179632) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[[3-(2-methylbutyl)-2-(oxiran-2-ylmethoxy)phenyl]methyl]oxirane.
| Compound Name | 2-[[3-(2-methylbutyl)-2-(oxiran-2-ylmethoxy)phenyl]methyl]oxirane |
|---|---|
| PubChem CID | 89179632 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-[[3-(2-methylbutyl)-2-(oxiran-2-ylmethoxy)phenyl]methyl]oxirane |
| SMILES | CCC(C)Cc1cccc(CC2CO2)c1OCC1CO1 |
| InChI | InChI=1S/C17H24O3/c1-3-12(2)7-13-5-4-6-14(8-15-9-18-15)17(13)20-11-16-10-19-16/h4-6,12,15-16H,3,7-11H2,1-2H3 |
| InChIKey | MIGWWMKXPFZRSS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|