C11H14O2 — CID 7127515
(2R)-2-[(2,6-dimethylphenoxy)methyl]oxirane (PubChem CID 7127515) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2R)-2-[(2,6-dimethylphenoxy)methyl]oxirane.
| Compound Name | (2R)-2-[(2,6-dimethylphenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 7127515 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2R)-2-[(2,6-dimethylphenoxy)methyl]oxirane |
| SMILES | Cc1cccc(C)c1OC[C@H]1CO1 |
| InChI | InChI=1S/C11H14O2/c1-8-4-3-5-9(2)11(8)13-7-10-6-12-10/h3-5,10H,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | VHWHISLSSKROOL-SNVBAGLBSA-N |
| XLogP | 2.08 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|