C10H13NaO5S — CID 22892677
sodium 2-(2,4-dimethylphenoxy)ethyl sulfate (PubChem CID 22892677) has the molecular formula C10H13NaO5S and a molecular weight of 268.27 g/mol. Its IUPAC name is sodium 2-(2,4-dimethylphenoxy)ethyl sulfate.
| Compound Name | sodium 2-(2,4-dimethylphenoxy)ethyl sulfate |
|---|---|
| PubChem CID | 22892677 |
| Molecular Formula | C10H13NaO5S |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | sodium 2-(2,4-dimethylphenoxy)ethyl sulfate |
| SMILES | Cc1ccc(OCCOS(=O)(=O)[O-])c(C)c1.[Na+] |
| InChI | InChI=1S/C10H14O5S.Na/c1-8-3-4-10(9(2)7-8)14-5-6-15-16(11,12)13;/h3-4,7H,5-6H2,1-2H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | AQPGTIKMAIWTAE-UHFFFAOYSA-M |
| XLogP | -1.84 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|