sodium 2-(2,4-dimethylphenoxy)ethyl sulfate

C10H13NaO5S — CID 22892677

IUPACsodium 2-(2,4-dimethylphenoxy)ethyl sulfate
SMILESCc1ccc(OCCOS(=O)(=O)[O-])c(C)c1.[Na+]
InChIInChI=1S/C10H14O5S.Na/c1-8-3-4-10(9(2)7-8)14-5-6-15-16(11,12)13;/h3-4,7H,5-6H2,1-2H3,(H,11,12,13);/q;+1/p-1
InChIKeyAQPGTIKMAIWTAE-UHFFFAOYSA-M
MW268.27 g/mol
LogP-1.84
Rot. Bonds5

About sodium 2-(2,4-dimethylphenoxy)ethyl sulfate

sodium 2-(2,4-dimethylphenoxy)ethyl sulfate (PubChem CID 22892677) has the molecular formula C10H13NaO5S and a molecular weight of 268.27 g/mol. Its IUPAC name is sodium 2-(2,4-dimethylphenoxy)ethyl sulfate.

Molecular Properties

Compound Namesodium 2-(2,4-dimethylphenoxy)ethyl sulfate
PubChem CID22892677
Molecular FormulaC10H13NaO5S
Molecular Weight268.27 g/mol
Exact Mass268.04
IUPAC Namesodium 2-(2,4-dimethylphenoxy)ethyl sulfate
SMILESCc1ccc(OCCOS(=O)(=O)[O-])c(C)c1.[Na+]
InChIInChI=1S/C10H14O5S.Na/c1-8-3-4-10(9(2)7-8)14-5-6-15-16(11,12)13;/h3-4,7H,5-6H2,1-2H3,(H,11,12,13);/q;+1/p-1
InChIKeyAQPGTIKMAIWTAE-UHFFFAOYSA-M
XLogP-1.84
TPSA75.66 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.27
LogP ≤ 5-1.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}

Analyze sodium 2-(2,4-dimethylphenoxy)ethyl sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-(2,4-dimethylphenoxy)ethyl sulfate?
The IUPAC name of sodium 2-(2,4-dimethylphenoxy)ethyl sulfate (CID 22892677) is sodium 2-(2,4-dimethylphenoxy)ethyl sulfate.
What is the SMILES notation for sodium 2-(2,4-dimethylphenoxy)ethyl sulfate?
The canonical SMILES for sodium 2-(2,4-dimethylphenoxy)ethyl sulfate is Cc1ccc(OCCOS(=O)(=O)[O-])c(C)c1.[Na+].
What is the InChIKey of sodium 2-(2,4-dimethylphenoxy)ethyl sulfate?
The InChIKey is AQPGTIKMAIWTAE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14O5S.Na/c1-8-3-4-10(9(2)7-8)14-5-6-15-16(11,12)13;/h3-4,7H,5-6H2,1-2H3,(H,11,12,13);/q;+1/p-1.
What are the key properties of sodium 2-(2,4-dimethylphenoxy)ethyl sulfate?
sodium 2-(2,4-dimethylphenoxy)ethyl sulfate has a molecular weight of 268.27 g/mol, XLogP of -1.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(2,4-dimethylphenoxy)ethyl sulfate is sourced from PubChem (CID 22892677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).