C9H11FO — CID 58637499
1-(fluoromethoxy)-2,4-dimethylbenzene (PubChem CID 58637499) has the molecular formula C9H11FO and a molecular weight of 154.18 g/mol. Its IUPAC name is 1-(fluoromethoxy)-2,4-dimethylbenzene.
| Compound Name | 1-(fluoromethoxy)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 58637499 |
| Molecular Formula | C9H11FO |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 1-(fluoromethoxy)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(OCF)c(C)c1 |
| InChI | InChI=1S/C9H11FO/c1-7-3-4-9(11-6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
| InChIKey | BUGOKOAVFHLASG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |