C9H10F2O2 — CID 57206944
1,2-bis(fluoromethoxy)-4-methylbenzene (PubChem CID 57206944) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 1,2-bis(fluoromethoxy)-4-methylbenzene.
| Compound Name | 1,2-bis(fluoromethoxy)-4-methylbenzene |
|---|---|
| PubChem CID | 57206944 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1,2-bis(fluoromethoxy)-4-methylbenzene |
| SMILES | Cc1ccc(OCF)c(OCF)c1 |
| InChI | InChI=1S/C9H10F2O2/c1-7-2-3-8(12-5-10)9(4-7)13-6-11/h2-4H,5-6H2,1H3 |
| InChIKey | UNRJMOPNLFDKJX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |