About CID 67422978
CID 67422978 (PubChem CID 67422978) has the molecular formula C18H22BO4
and a molecular weight of 313.18 g/mol.
Molecular Properties
| Compound Name | CID 67422978 |
| PubChem CID | 67422978 |
| Molecular Formula | C18H22BO4 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | — |
| SMILES | CCOc1ccc(C)cc1O[B]Oc1cc(C)ccc1OCC |
| InChI | InChI=1S/C18H22BO4/c1-5-20-15-9-7-13(3)11-17(15)22-19-23-18-12-14(4)8-10-16(18)21-6-2/h7-12H,5-6H2,1-4H3 |
| InChIKey | VUYFYJMFXIDJHW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67422978 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67422978?
The IUPAC name of CID 67422978 (CID 67422978) is not available.
What is the SMILES notation for CID 67422978?
The canonical SMILES for CID 67422978 is CCOc1ccc(C)cc1O[B]Oc1cc(C)ccc1OCC.
What is the InChIKey of CID 67422978?
The InChIKey is VUYFYJMFXIDJHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22BO4/c1-5-20-15-9-7-13(3)11-17(15)22-19-23-18-12-14(4)8-10-16(18)21-6-2/h7-12H,5-6H2,1-4H3.
What are the key properties of CID 67422978?
CID 67422978 has a molecular weight of 313.18 g/mol, XLogP of 4.09, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67422978 is sourced from PubChem (CID 67422978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).