C9H10F2O — CID 118830282
2-fluoro-1-(fluoromethoxy)-3,4-dimethylbenzene (PubChem CID 118830282) has the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. Its IUPAC name is 2-fluoro-1-(fluoromethoxy)-3,4-dimethylbenzene.
| Compound Name | 2-fluoro-1-(fluoromethoxy)-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 118830282 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-fluoro-1-(fluoromethoxy)-3,4-dimethylbenzene |
| SMILES | Cc1ccc(OCF)c(F)c1C |
| InChI | InChI=1S/C9H10F2O/c1-6-3-4-8(12-5-10)9(11)7(6)2/h3-4H,5H2,1-2H3 |
| InChIKey | HOBOELORFRVKJO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |