C9H10ClF — CID 130837762
1-(chloromethyl)-2-fluoro-3,4-dimethylbenzene (PubChem CID 130837762) has the molecular formula C9H10ClF and a molecular weight of 172.63 g/mol. Its IUPAC name is 1-(chloromethyl)-2-fluoro-3,4-dimethylbenzene.
| Compound Name | 1-(chloromethyl)-2-fluoro-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 130837762 |
| Molecular Formula | C9H10ClF |
| Molecular Weight | 172.63 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1-(chloromethyl)-2-fluoro-3,4-dimethylbenzene |
| SMILES | Cc1ccc(CCl)c(F)c1C |
| InChI | InChI=1S/C9H10ClF/c1-6-3-4-8(5-10)9(11)7(6)2/h3-4H,5H2,1-2H3 |
| InChIKey | SETYVIOUSVDHJS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|