C8H4ClF5 — CID 121234690
1-(chloromethyl)-2,3-difluoro-4-(trifluoromethyl)benzene (PubChem CID 121234690) has the molecular formula C8H4ClF5 and a molecular weight of 230.56 g/mol. Its IUPAC name is 1-(chloromethyl)-2,3-difluoro-4-(trifluoromethyl)benzene.
| Compound Name | 1-(chloromethyl)-2,3-difluoro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 121234690 |
| Molecular Formula | C8H4ClF5 |
| Molecular Weight | 230.56 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 1-(chloromethyl)-2,3-difluoro-4-(trifluoromethyl)benzene |
| SMILES | Fc1c(CCl)ccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C8H4ClF5/c9-3-4-1-2-5(8(12,13)14)7(11)6(4)10/h1-2H,3H2 |
| InChIKey | UMLZVJDTUUXSJF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|