C9H4ClF7 — CID 134617827
1-(chloromethyl)-3-fluoro-2,4-bis(trifluoromethyl)benzene (PubChem CID 134617827) has the molecular formula C9H4ClF7 and a molecular weight of 280.57 g/mol. Its IUPAC name is 1-(chloromethyl)-3-fluoro-2,4-bis(trifluoromethyl)benzene.
| Compound Name | 1-(chloromethyl)-3-fluoro-2,4-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134617827 |
| Molecular Formula | C9H4ClF7 |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 1-(chloromethyl)-3-fluoro-2,4-bis(trifluoromethyl)benzene |
| SMILES | Fc1c(C(F)(F)F)ccc(CCl)c1C(F)(F)F |
| InChI | InChI=1S/C9H4ClF7/c10-3-4-1-2-5(8(12,13)14)7(11)6(4)9(15,16)17/h1-2H,3H2 |
| InChIKey | LDRWITWMEXWHKE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|