C9H4F5N — CID 169008633
2,3-difluoro-1-(isocyanomethyl)-4-(trifluoromethyl)benzene (PubChem CID 169008633) has the molecular formula C9H4F5N and a molecular weight of 221.13 g/mol. Its IUPAC name is 2,3-difluoro-1-(isocyanomethyl)-4-(trifluoromethyl)benzene.
| Compound Name | 2,3-difluoro-1-(isocyanomethyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 169008633 |
| Molecular Formula | C9H4F5N |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2,3-difluoro-1-(isocyanomethyl)-4-(trifluoromethyl)benzene |
| SMILES | [C-]#[N+]Cc1ccc(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C9H4F5N/c1-15-4-5-2-3-6(9(12,13)14)8(11)7(5)10/h2-3H,4H2 |
| InChIKey | GJNRIBATARFJNR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|