About 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene
1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene (PubChem CID 19690541) has the molecular formula C9H3F5
and a molecular weight of 206.11 g/mol. Its IUPAC name is 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene |
| PubChem CID | 19690541 |
| Molecular Formula | C9H3F5 |
| Molecular Weight | 206.11 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene |
| SMILES | C#Cc1ccc(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C9H3F5/c1-2-5-3-4-6(9(12,13)14)8(11)7(5)10/h1,3-4H |
| InChIKey | WWLDYGSMFSRIMY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.11 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene?
The IUPAC name of 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene (CID 19690541) is 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene.
What is the SMILES notation for 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene?
The canonical SMILES for 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene is C#Cc1ccc(C(F)(F)F)c(F)c1F.
What is the InChIKey of 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene?
The InChIKey is WWLDYGSMFSRIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3F5/c1-2-5-3-4-6(9(12,13)14)8(11)7(5)10/h1,3-4H.
What are the key properties of 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene?
1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene has a molecular weight of 206.11 g/mol, XLogP of 2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-2,3-difluoro-4-(trifluoromethyl)benzene is sourced from PubChem (CID 19690541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).