C9H4BrF7 — CID 134623922
2-(bromomethyl)-3-fluoro-1,4-bis(trifluoromethyl)benzene (PubChem CID 134623922) has the molecular formula C9H4BrF7 and a molecular weight of 325.02 g/mol. Its IUPAC name is 2-(bromomethyl)-3-fluoro-1,4-bis(trifluoromethyl)benzene.
| Compound Name | 2-(bromomethyl)-3-fluoro-1,4-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134623922 |
| Molecular Formula | C9H4BrF7 |
| Molecular Weight | 325.02 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | 2-(bromomethyl)-3-fluoro-1,4-bis(trifluoromethyl)benzene |
| SMILES | Fc1c(C(F)(F)F)ccc(C(F)(F)F)c1CBr |
| InChI | InChI=1S/C9H4BrF7/c10-3-4-5(8(12,13)14)1-2-6(7(4)11)9(15,16)17/h1-2H,3H2 |
| InChIKey | IEDXKMMUVFDVBU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.02 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|