C10H4BrF6N — CID 134623919
2-(bromomethyl)-3,6-bis(trifluoromethyl)benzonitrile (PubChem CID 134623919) has the molecular formula C10H4BrF6N and a molecular weight of 332.04 g/mol. Its IUPAC name is 2-(bromomethyl)-3,6-bis(trifluoromethyl)benzonitrile.
| Compound Name | 2-(bromomethyl)-3,6-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 134623919 |
| Molecular Formula | C10H4BrF6N |
| Molecular Weight | 332.04 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | 2-(bromomethyl)-3,6-bis(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1c(C(F)(F)F)ccc(C(F)(F)F)c1CBr |
| InChI | InChI=1S/C10H4BrF6N/c11-3-5-6(4-18)8(10(15,16)17)2-1-7(5)9(12,13)14/h1-2H,3H2 |
| InChIKey | WZZQPMXPZFHGPS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.04 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|