C10H7F5O2 — CID 67079520
3-[2,3-difluoro-4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 67079520) has the molecular formula C10H7F5O2 and a molecular weight of 254.15 g/mol. Its IUPAC name is 3-[2,3-difluoro-4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-[2,3-difluoro-4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67079520 |
| Molecular Formula | C10H7F5O2 |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 3-[2,3-difluoro-4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C10H7F5O2/c11-8-5(2-4-7(16)17)1-3-6(9(8)12)10(13,14)15/h1,3H,2,4H2,(H,16,17) |
| InChIKey | HOSBDFQVCYVDGK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |