C11H4F6N2 — CID 168854550
4-(isocyanomethyl)-2,3-bis(trifluoromethyl)benzonitrile (PubChem CID 168854550) has the molecular formula C11H4F6N2 and a molecular weight of 278.16 g/mol. Its IUPAC name is 4-(isocyanomethyl)-2,3-bis(trifluoromethyl)benzonitrile.
| Compound Name | 4-(isocyanomethyl)-2,3-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 168854550 |
| Molecular Formula | C11H4F6N2 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-(isocyanomethyl)-2,3-bis(trifluoromethyl)benzonitrile |
| SMILES | [C-]#[N+]Cc1ccc(C#N)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C11H4F6N2/c1-19-5-7-3-2-6(4-18)8(10(12,13)14)9(7)11(15,16)17/h2-3H,5H2 |
| InChIKey | DRRVWMUUSGUBDJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|