C9H3F6NO — CID 134639144
2-hydroxy-3,4-bis(trifluoromethyl)benzonitrile (PubChem CID 134639144) has the molecular formula C9H3F6NO and a molecular weight of 255.12 g/mol. Its IUPAC name is 2-hydroxy-3,4-bis(trifluoromethyl)benzonitrile.
| Compound Name | 2-hydroxy-3,4-bis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 134639144 |
| Molecular Formula | C9H3F6NO |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 2-hydroxy-3,4-bis(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)c(C(F)(F)F)c1O |
| InChI | InChI=1S/C9H3F6NO/c10-8(11,12)5-2-1-4(3-16)7(17)6(5)9(13,14)15/h1-2,17H |
| InChIKey | IVEIVOYEBWSMHX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |