C10H8F3NO2 — CID 117333541
2,3-dimethoxy-4-(trifluoromethyl)benzonitrile (PubChem CID 117333541) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 2,3-dimethoxy-4-(trifluoromethyl)benzonitrile.
| Compound Name | 2,3-dimethoxy-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 117333541 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2,3-dimethoxy-4-(trifluoromethyl)benzonitrile |
| SMILES | COc1c(C#N)ccc(C(F)(F)F)c1OC |
| InChI | InChI=1S/C10H8F3NO2/c1-15-8-6(5-14)3-4-7(9(8)16-2)10(11,12)13/h3-4H,1-2H3 |
| InChIKey | CCRFHMVVPJWEAE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |