C9H5FN2O — CID 118901962
4-fluoro-2-methoxybenzene-1,3-dicarbonitrile (PubChem CID 118901962) has the molecular formula C9H5FN2O and a molecular weight of 176.15 g/mol. Its IUPAC name is 4-fluoro-2-methoxybenzene-1,3-dicarbonitrile.
| Compound Name | 4-fluoro-2-methoxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 118901962 |
| Molecular Formula | C9H5FN2O |
| Molecular Weight | 176.15 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 4-fluoro-2-methoxybenzene-1,3-dicarbonitrile |
| SMILES | COc1c(C#N)ccc(F)c1C#N |
| InChI | InChI=1S/C9H5FN2O/c1-13-9-6(4-11)2-3-8(10)7(9)5-12/h2-3H,1H3 |
| InChIKey | MVUUYBRYWBGMOB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |