About 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile
5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile (PubChem CID 174342145) has the molecular formula C12H3F6N3
and a molecular weight of 303.17 g/mol. Its IUPAC name is 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile |
| PubChem CID | 174342145 |
| Molecular Formula | C12H3F6N3 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile |
| SMILES | N#CCc1cc(C#N)c(C(F)(F)F)c(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C12H3F6N3/c13-11(14,15)9-7(4-20)3-6(1-2-19)8(5-21)10(9)12(16,17)18/h3H,1H2 |
| InChIKey | DDAFVEJEXDNXHP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile?
The IUPAC name of 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile (CID 174342145) is 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile.
What is the SMILES notation for 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile?
The canonical SMILES for 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile is N#CCc1cc(C#N)c(C(F)(F)F)c(C(F)(F)F)c1C#N.
What is the InChIKey of 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile?
The InChIKey is DDAFVEJEXDNXHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H3F6N3/c13-11(14,15)9-7(4-20)3-6(1-2-19)8(5-21)10(9)12(16,17)18/h3H,1H2.
What are the key properties of 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile?
5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile has a molecular weight of 303.17 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyanomethyl)-2,3-bis(trifluoromethyl)benzene-1,4-dicarbonitrile is sourced from PubChem (CID 174342145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).