C13H2F12N2 — CID 174341924
4-(cyanomethyl)-2,3,5,6-tetrakis(trifluoromethyl)benzonitrile (PubChem CID 174341924) has the molecular formula C13H2F12N2 and a molecular weight of 414.15 g/mol. Its IUPAC name is 4-(cyanomethyl)-2,3,5,6-tetrakis(trifluoromethyl)benzonitrile.
| Compound Name | 4-(cyanomethyl)-2,3,5,6-tetrakis(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 174341924 |
| Molecular Formula | C13H2F12N2 |
| Molecular Weight | 414.15 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 4-(cyanomethyl)-2,3,5,6-tetrakis(trifluoromethyl)benzonitrile |
| SMILES | N#CCc1c(C(F)(F)F)c(C(F)(F)F)c(C#N)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C13H2F12N2/c14-10(15,16)6-4(1-2-26)7(11(17,18)19)9(13(23,24)25)5(3-27)8(6)12(20,21)22/h1H2 |
| InChIKey | SBBXRTWUFNAFIA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.15 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |