C11H2F9N3 — CID 139999966
3-amino-4,5,6-tris(trifluoromethyl)benzene-1,2-dicarbonitrile (PubChem CID 139999966) has the molecular formula C11H2F9N3 and a molecular weight of 347.14 g/mol. Its IUPAC name is 3-amino-4,5,6-tris(trifluoromethyl)benzene-1,2-dicarbonitrile.
| Compound Name | 3-amino-4,5,6-tris(trifluoromethyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139999966 |
| Molecular Formula | C11H2F9N3 |
| Molecular Weight | 347.14 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 3-amino-4,5,6-tris(trifluoromethyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C11H2F9N3/c12-9(13,14)5-3(1-21)4(2-22)8(23)7(11(18,19)20)6(5)10(15,16)17/h23H2 |
| InChIKey | IBPBEIXRGIXVDK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.14 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|