C9H4F4N4 — CID 10014687
3,4-diamino-5-fluoro-6-(trifluoromethyl)benzene-1,2-dicarbonitrile (PubChem CID 10014687) has the molecular formula C9H4F4N4 and a molecular weight of 244.15 g/mol. Its IUPAC name is 3,4-diamino-5-fluoro-6-(trifluoromethyl)benzene-1,2-dicarbonitrile.
| Compound Name | 3,4-diamino-5-fluoro-6-(trifluoromethyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 10014687 |
| Molecular Formula | C9H4F4N4 |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3,4-diamino-5-fluoro-6-(trifluoromethyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(N)c(N)c(F)c(C(F)(F)F)c1C#N |
| InChI | InChI=1S/C9H4F4N4/c10-6-5(9(11,12)13)3(1-14)4(2-15)7(16)8(6)17/h16-17H2 |
| InChIKey | LYPQPOVGAQLZOU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|