C12F12N2 — CID 139951157
3,5-difluoro-4,6-bis(1,1,2,2,2-pentafluoroethyl)benzene-1,2-dicarbonitrile (PubChem CID 139951157) has the molecular formula C12F12N2 and a molecular weight of 400.12 g/mol. Its IUPAC name is 3,5-difluoro-4,6-bis(1,1,2,2,2-pentafluoroethyl)benzene-1,2-dicarbonitrile.
| Compound Name | 3,5-difluoro-4,6-bis(1,1,2,2,2-pentafluoroethyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139951157 |
| Molecular Formula | C12F12N2 |
| Molecular Weight | 400.12 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 3,5-difluoro-4,6-bis(1,1,2,2,2-pentafluoroethyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(F)c(C(F)(F)C(F)(F)F)c(F)c(C(F)(F)C(F)(F)F)c1C#N |
| InChI | InChI=1S/C12F12N2/c13-7-4(2-26)3(1-25)5(9(15,16)11(19,20)21)8(14)6(7)10(17,18)12(22,23)24 |
| InChIKey | DKQAJONTLUOFTH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.12 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|