C22F10N4O2 — CID 142705147
3-[4-(2,3-dicyano-4,5,6-trifluorophenoxy)-2,3,5,6-tetrafluorophenoxy]-4,5,6-trifluorobenzene-1,2-dicarbonitrile (PubChem CID 142705147) has the molecular formula C22F10N4O2 and a molecular weight of 542.25 g/mol. Its IUPAC name is 3-[4-(2,3-dicyano-4,5,6-trifluorophenoxy)-2,3,5,6-tetrafluorophenoxy]-4,5,6-trifluorobenzene-1,2-dicarbonitrile.
| Compound Name | 3-[4-(2,3-dicyano-4,5,6-trifluorophenoxy)-2,3,5,6-tetrafluorophenoxy]-4,5,6-trifluorobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 142705147 |
| Molecular Formula | C22F10N4O2 |
| Molecular Weight | 542.25 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | 3-[4-(2,3-dicyano-4,5,6-trifluorophenoxy)-2,3,5,6-tetrafluorophenoxy]-4,5,6-trifluorobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(F)c(F)c(F)c(Oc2c(F)c(F)c(Oc3c(F)c(F)c(F)c(C#N)c3C#N)c(F)c2F)c1C#N |
| InChI | InChI=1S/C22F10N4O2/c23-9-5(1-33)7(3-35)19(13(27)11(9)25)37-21-15(29)17(31)22(18(32)16(21)30)38-20-8(4-36)6(2-34)10(24)12(26)14(20)28 |
| InChIKey | GQPRWNXXHMNMAA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.25 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|