C9F3N3 — CID 12745042
2,4,6-trifluorobenzene-1,3,5-tricarbonitrile (PubChem CID 12745042) has the molecular formula C9F3N3 and a molecular weight of 207.11 g/mol. Its IUPAC name is 2,4,6-trifluorobenzene-1,3,5-tricarbonitrile.
| Compound Name | 2,4,6-trifluorobenzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 12745042 |
| Molecular Formula | C9F3N3 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | 2,4,6-trifluorobenzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1c(F)c(C#N)c(F)c(C#N)c1F |
| InChI | InChI=1S/C9F3N3/c10-7-4(1-13)8(11)6(3-15)9(12)5(7)2-14 |
| InChIKey | LWTFYBZNGZGGRD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |