C26F10N6 — CID 90738465
3,6-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-2,5-difluorocyclohexa-1,4-diene-1,4-dicarbonitrile (PubChem CID 90738465) has the molecular formula C26F10N6 and a molecular weight of 586.31 g/mol. Its IUPAC name is 3,6-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-2,5-difluorocyclohexa-1,4-diene-1,4-dicarbonitrile.
| Compound Name | 3,6-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-2,5-difluorocyclohexa-1,4-diene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 90738465 |
| Molecular Formula | C26F10N6 |
| Molecular Weight | 586.31 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | 3,6-bis[cyano-(4-cyano-2,3,5,6-tetrafluorophenyl)methylidene]-2,5-difluorocyclohexa-1,4-diene-1,4-dicarbonitrile |
| SMILES | N#CC(c1c(F)c(F)c(C#N)c(F)c1F)=c1c(F)c(C#N)c(=C(C#N)c2c(F)c(F)c(C#N)c(F)c2F)c(F)c1C#N |
| InChI | InChI=1S/C26F10N6/c27-17-10(4-40)14(8(2-38)16-25(35)21(31)12(6-42)22(32)26(16)36)18(28)9(3-39)13(17)7(1-37)15-23(33)19(29)11(5-41)20(30)24(15)34 |
| InChIKey | QDPXCLLZLKHVSQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|