C16F8N4 — CID 87620295
2,3,5,6-tetrafluorobenzene-1,4-dicarbonitrile;2,4,5,6-tetrafluorobenzene-1,3-dicarbonitrile (PubChem CID 87620295) has the molecular formula C16F8N4 and a molecular weight of 400.19 g/mol. Its IUPAC name is 2,3,5,6-tetrafluorobenzene-1,4-dicarbonitrile;2,4,5,6-tetrafluorobenzene-1,3-dicarbonitrile.
| Compound Name | 2,3,5,6-tetrafluorobenzene-1,4-dicarbonitrile;2,4,5,6-tetrafluorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 87620295 |
| Molecular Formula | C16F8N4 |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 2,3,5,6-tetrafluorobenzene-1,4-dicarbonitrile;2,4,5,6-tetrafluorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(F)c(C#N)c(F)c1F.N#Cc1c(F)c(F)c(F)c(C#N)c1F |
| InChI | InChI=1S/2C8F4N2/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11;9-5-3(1-13)6(10)8(12)7(11)4(5)2-14 |
| InChIKey | SNIKFJDMELWWEA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|