C8HF4NO — CID 131607107
2,3,5,6-tetrafluoro-4-formylbenzonitrile (PubChem CID 131607107) has the molecular formula C8HF4NO and a molecular weight of 203.09 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-formylbenzonitrile.
| Compound Name | 2,3,5,6-tetrafluoro-4-formylbenzonitrile |
|---|---|
| PubChem CID | 131607107 |
| Molecular Formula | C8HF4NO |
| Molecular Weight | 203.09 g/mol |
| Exact Mass | 203.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-formylbenzonitrile |
| SMILES | N#Cc1c(F)c(F)c(C=O)c(F)c1F |
| InChI | InChI=1S/C8HF4NO/c9-5-3(1-13)6(10)8(12)4(2-14)7(5)11/h2H |
| InChIKey | IBYNPXFSPULPPU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|