C9H4FNO2 — CID 171011652
2-fluoro-3,6-diformylbenzonitrile (PubChem CID 171011652) has the molecular formula C9H4FNO2 and a molecular weight of 177.13 g/mol. Its IUPAC name is 2-fluoro-3,6-diformylbenzonitrile.
| Compound Name | 2-fluoro-3,6-diformylbenzonitrile |
|---|---|
| PubChem CID | 171011652 |
| Molecular Formula | C9H4FNO2 |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 2-fluoro-3,6-diformylbenzonitrile |
| SMILES | N#Cc1c(C=O)ccc(C=O)c1F |
| InChI | InChI=1S/C9H4FNO2/c10-9-7(5-13)2-1-6(4-12)8(9)3-11/h1-2,4-5H |
| InChIKey | TUGANDXCVXEHFY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|