C8H3F4NO — CID 174393196
formyl fluoride;2,3,6-trifluorobenzonitrile (PubChem CID 174393196) has the molecular formula C8H3F4NO and a molecular weight of 205.11 g/mol. Its IUPAC name is formyl fluoride;2,3,6-trifluorobenzonitrile.
| Compound Name | formyl fluoride;2,3,6-trifluorobenzonitrile |
|---|---|
| PubChem CID | 174393196 |
| Molecular Formula | C8H3F4NO |
| Molecular Weight | 205.11 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | formyl fluoride;2,3,6-trifluorobenzonitrile |
| SMILES | N#Cc1c(F)ccc(F)c1F.O=CF |
| InChI | InChI=1S/C7H2F3N.CHFO/c8-5-1-2-6(9)7(10)4(5)3-11;2-1-3/h1-2H;1H |
| InChIKey | HIRZMOQYJYEFPL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.11 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|