About disodium;2,6-difluoro-3-phosphonatobenzonitrile
disodium;2,6-difluoro-3-phosphonatobenzonitrile (PubChem CID 141429115) has the molecular formula C7H2F2NNa2O3P
and a molecular weight of 263.05 g/mol. Its IUPAC name is disodium;2,6-difluoro-3-phosphonatobenzonitrile.
Molecular Properties
| Compound Name | disodium;2,6-difluoro-3-phosphonatobenzonitrile |
| PubChem CID | 141429115 |
| Molecular Formula | C7H2F2NNa2O3P |
| Molecular Weight | 263.05 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | disodium;2,6-difluoro-3-phosphonatobenzonitrile |
| SMILES | N#Cc1c(F)ccc(P(=O)([O-])[O-])c1F.[Na+].[Na+] |
| InChI | InChI=1S/C7H4F2NO3P.2Na/c8-5-1-2-6(14(11,12)13)7(9)4(5)3-10;;/h1-2H,(H2,11,12,13);;/q;2*+1/p-2 |
| InChIKey | WLKJEYGXHDAAFR-UHFFFAOYSA-L |
| XLogP | -6.62 |
| TPSA | 86.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.05 |
| LogP ≤ 5 | -6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2,6-difluoro-3-phosphonatobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2,6-difluoro-3-phosphonatobenzonitrile?
The IUPAC name of disodium;2,6-difluoro-3-phosphonatobenzonitrile (CID 141429115) is disodium;2,6-difluoro-3-phosphonatobenzonitrile.
What is the SMILES notation for disodium;2,6-difluoro-3-phosphonatobenzonitrile?
The canonical SMILES for disodium;2,6-difluoro-3-phosphonatobenzonitrile is N#Cc1c(F)ccc(P(=O)([O-])[O-])c1F.[Na+].[Na+].
What is the InChIKey of disodium;2,6-difluoro-3-phosphonatobenzonitrile?
The InChIKey is WLKJEYGXHDAAFR-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H4F2NO3P.2Na/c8-5-1-2-6(14(11,12)13)7(9)4(5)3-10;;/h1-2H,(H2,11,12,13);;/q;2*+1/p-2.
What are the key properties of disodium;2,6-difluoro-3-phosphonatobenzonitrile?
disodium;2,6-difluoro-3-phosphonatobenzonitrile has a molecular weight of 263.05 g/mol, XLogP of -6.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2,6-difluoro-3-phosphonatobenzonitrile is sourced from PubChem (CID 141429115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).