C7H2F2NNa2O3P — CID 141429115
disodium;2,6-difluoro-3-phosphonatobenzonitrile (PubChem CID 141429115) has the molecular formula C7H2F2NNa2O3P and a molecular weight of 263.05 g/mol. Its IUPAC name is disodium;2,6-difluoro-3-phosphonatobenzonitrile.
| Compound Name | disodium;2,6-difluoro-3-phosphonatobenzonitrile |
|---|---|
| PubChem CID | 141429115 |
| Molecular Formula | C7H2F2NNa2O3P |
| Molecular Weight | 263.05 g/mol |
| Exact Mass | 262.95 |
| IUPAC Name | disodium;2,6-difluoro-3-phosphonatobenzonitrile |
| SMILES | N#Cc1c(F)ccc(P(=O)([O-])[O-])c1F.[Na+].[Na+] |
| InChI | InChI=1S/C7H4F2NO3P.2Na/c8-5-1-2-6(14(11,12)13)7(9)4(5)3-10;;/h1-2H,(H2,11,12,13);;/q;2*+1/p-2 |
| InChIKey | WLKJEYGXHDAAFR-UHFFFAOYSA-L |
| XLogP | -6.62 |
| TPSA | 86.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.05 |
| LogP ≤ 5 | -6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|