C7HBrF3N — CID 117344080
3-bromo-2,4,6-trifluorobenzonitrile (PubChem CID 117344080) has the molecular formula C7HBrF3N and a molecular weight of 235.99 g/mol. Its IUPAC name is 3-bromo-2,4,6-trifluorobenzonitrile.
| Compound Name | 3-bromo-2,4,6-trifluorobenzonitrile |
|---|---|
| PubChem CID | 117344080 |
| Molecular Formula | C7HBrF3N |
| Molecular Weight | 235.99 g/mol |
| Exact Mass | 234.92 |
| IUPAC Name | 3-bromo-2,4,6-trifluorobenzonitrile |
| SMILES | N#Cc1c(F)cc(F)c(Br)c1F |
| InChI | InChI=1S/C7HBrF3N/c8-6-5(10)1-4(9)3(2-12)7(6)11/h1H |
| InChIKey | UIUCMIXRKOCUIV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.99 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|