C7H3F3N2 — CID 141312081
4-amino-2,3,6-trifluorobenzonitrile (PubChem CID 141312081) has the molecular formula C7H3F3N2 and a molecular weight of 172.11 g/mol. Its IUPAC name is 4-amino-2,3,6-trifluorobenzonitrile.
| Compound Name | 4-amino-2,3,6-trifluorobenzonitrile |
|---|---|
| PubChem CID | 141312081 |
| Molecular Formula | C7H3F3N2 |
| Molecular Weight | 172.11 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 4-amino-2,3,6-trifluorobenzonitrile |
| SMILES | N#Cc1c(F)cc(N)c(F)c1F |
| InChI | InChI=1S/C7H3F3N2/c8-4-1-5(12)7(10)6(9)3(4)2-11/h1H,12H2 |
| InChIKey | NJKNYDHTFWFZEA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.11 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|