C8H3F4N — CID 119018224
4-(difluoromethyl)-2,6-difluorobenzonitrile (PubChem CID 119018224) has the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,6-difluorobenzonitrile.
| Compound Name | 4-(difluoromethyl)-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 119018224 |
| Molecular Formula | C8H3F4N |
| Molecular Weight | 189.11 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 4-(difluoromethyl)-2,6-difluorobenzonitrile |
| SMILES | N#Cc1c(F)cc(C(F)F)cc1F |
| InChI | InChI=1S/C8H3F4N/c9-6-1-4(8(11)12)2-7(10)5(6)3-13/h1-2,8H |
| InChIKey | ODTKGYFXSRDBOY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.11 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |