C10H9F2NO2 — CID 123326116
4-(dimethoxymethyl)-2,6-difluorobenzonitrile (PubChem CID 123326116) has the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2,6-difluorobenzonitrile.
| Compound Name | 4-(dimethoxymethyl)-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 123326116 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-(dimethoxymethyl)-2,6-difluorobenzonitrile |
| SMILES | COC(OC)c1cc(F)c(C#N)c(F)c1 |
| InChI | InChI=1S/C10H9F2NO2/c1-14-10(15-2)6-3-8(11)7(5-13)9(12)4-6/h3-4,10H,1-2H3 |
| InChIKey | WCUBUAGMCFMGEQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|