C11H9F2NO4 — CID 171878096
4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878096) has the molecular formula C11H9F2NO4 and a molecular weight of 257.19 g/mol. Its IUPAC name is 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878096 |
| Molecular Formula | C11H9F2NO4 |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid |
| SMILES | N#Cc1c(F)cc(C(O)C(O)CC(=O)O)cc1F |
| InChI | InChI=1S/C11H9F2NO4/c12-7-1-5(2-8(13)6(7)4-14)11(18)9(15)3-10(16)17/h1-2,9,11,15,18H,3H2,(H,16,17) |
| InChIKey | HZOKIEVEJDYGFH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |