4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid

C11H9F2NO4 — CID 171878096

IUPAC4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid
SMILESN#Cc1c(F)cc(C(O)C(O)CC(=O)O)cc1F
InChIInChI=1S/C11H9F2NO4/c12-7-1-5(2-8(13)6(7)4-14)11(18)9(15)3-10(16)17/h1-2,9,11,15,18H,3H2,(H,16,17)
InChIKeyHZOKIEVEJDYGFH-UHFFFAOYSA-N
MW257.19 g/mol
LogP0.71
Rot. Bonds4

About 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid

4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878096) has the molecular formula C11H9F2NO4 and a molecular weight of 257.19 g/mol. Its IUPAC name is 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid.

Molecular Properties

Compound Name4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid
PubChem CID171878096
Molecular FormulaC11H9F2NO4
Molecular Weight257.19 g/mol
Exact Mass257.05
IUPAC Name4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid
SMILESN#Cc1c(F)cc(C(O)C(O)CC(=O)O)cc1F
InChIInChI=1S/C11H9F2NO4/c12-7-1-5(2-8(13)6(7)4-14)11(18)9(15)3-10(16)17/h1-2,9,11,15,18H,3H2,(H,16,17)
InChIKeyHZOKIEVEJDYGFH-UHFFFAOYSA-N
XLogP0.71
TPSA101.55 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.19
LogP ≤ 50.71
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid?
The IUPAC name of 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid (CID 171878096) is 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid.
What is the SMILES notation for 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid?
The canonical SMILES for 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid is N#Cc1c(F)cc(C(O)C(O)CC(=O)O)cc1F.
What is the InChIKey of 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid?
The InChIKey is HZOKIEVEJDYGFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO4/c12-7-1-5(2-8(13)6(7)4-14)11(18)9(15)3-10(16)17/h1-2,9,11,15,18H,3H2,(H,16,17).
What are the key properties of 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid?
4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid has a molecular weight of 257.19 g/mol, XLogP of 0.71, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyano-3,5-difluorophenyl)-3,4-dihydroxybutanoic acid is sourced from PubChem (CID 171878096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).