C11H12F2O5 — CID 171878022
4-(3,4-difluoro-5-methoxyphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878022) has the molecular formula C11H12F2O5 and a molecular weight of 262.21 g/mol. Its IUPAC name is 4-(3,4-difluoro-5-methoxyphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(3,4-difluoro-5-methoxyphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878022 |
| Molecular Formula | C11H12F2O5 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-(3,4-difluoro-5-methoxyphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | COc1cc(C(O)C(O)CC(=O)O)cc(F)c1F |
| InChI | InChI=1S/C11H12F2O5/c1-18-8-3-5(2-6(12)10(8)13)11(17)7(14)4-9(15)16/h2-3,7,11,14,17H,4H2,1H3,(H,15,16) |
| InChIKey | RNUKREAXZTVMGA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |